C28H26F3N3O9S — CID 16759844
trimethyl (1S,9R,15S)-4-methoxy-8-methyl-14-[4-(trifluoromethyl)phenyl]sulfonyl-8,12,14-triazatetracyclo[7.7.0.01,13.02,7]hexadeca-2(7),3,5,10,12-pentaene-10,11,15-tricarboxylate (PubChem CID 16759844) has the molecular formula C28H26F3N3O9S and a molecular weight of 637.59 g/mol. Its IUPAC name is trimethyl (1S,9R,15S)-4-methoxy-8-methyl-14-[4-(trifluoromethyl)phenyl]sulfonyl-8,12,14-triazatetracyclo[7.7.0.01,13.02,7]hexadeca-2(7),3,5,10,12-pentaene-10,11,15-tricarboxylate.
| Compound Name | trimethyl (1S,9R,15S)-4-methoxy-8-methyl-14-[4-(trifluoromethyl)phenyl]sulfonyl-8,12,14-triazatetracyclo[7.7.0.01,13.02,7]hexadeca-2(7),3,5,10,12-pentaene-10,11,15-tricarboxylate |
|---|---|
| PubChem CID | 16759844 |
| Molecular Formula | C28H26F3N3O9S |
| Molecular Weight | 637.59 g/mol |
| Exact Mass | 637.13 |
| IUPAC Name | trimethyl (1S,9R,15S)-4-methoxy-8-methyl-14-[4-(trifluoromethyl)phenyl]sulfonyl-8,12,14-triazatetracyclo[7.7.0.01,13.02,7]hexadeca-2(7),3,5,10,12-pentaene-10,11,15-tricarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)[C@@H]2N(C)c3ccc(OC)cc3[C@@]23C[C@@H](C(=O)OC)N(S(=O)(=O)c2ccc(C(F)(F)F)cc2)C3=N1 |
| InChI | InChI=1S/C28H26F3N3O9S/c1-33-18-11-8-15(40-2)12-17(18)27-13-19(23(35)41-3)34(44(38,39)16-9-6-14(7-10-16)28(29,30)31)26(27)32-21(25(37)43-5)20(22(27)33)24(36)42-4/h6-12,19,22H,13H2,1-5H3/t19-,22-,27-/m0/s1 |
| InChIKey | NHFGPGKTVSREKM-JNMBUGSCSA-N |
| XLogP | 2.42 |
| TPSA | 141.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.59 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|