C28H28N4O9S — CID 16759849
trimethyl (1S,9R,15S)-8-but-2-ynyl-14-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]-8,12,14-triazatetracyclo[7.7.0.01,13.02,7]hexadeca-2,4,6,10,12-pentaene-10,11,15-tricarboxylate (PubChem CID 16759849) has the molecular formula C28H28N4O9S and a molecular weight of 596.62 g/mol. Its IUPAC name is trimethyl (1S,9R,15S)-8-but-2-ynyl-14-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]-8,12,14-triazatetracyclo[7.7.0.01,13.02,7]hexadeca-2,4,6,10,12-pentaene-10,11,15-tricarboxylate.
| Compound Name | trimethyl (1S,9R,15S)-8-but-2-ynyl-14-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]-8,12,14-triazatetracyclo[7.7.0.01,13.02,7]hexadeca-2,4,6,10,12-pentaene-10,11,15-tricarboxylate |
|---|---|
| PubChem CID | 16759849 |
| Molecular Formula | C28H28N4O9S |
| Molecular Weight | 596.62 g/mol |
| Exact Mass | 596.16 |
| IUPAC Name | trimethyl (1S,9R,15S)-8-but-2-ynyl-14-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]-8,12,14-triazatetracyclo[7.7.0.01,13.02,7]hexadeca-2,4,6,10,12-pentaene-10,11,15-tricarboxylate |
| SMILES | CC#CCN1c2ccccc2[C@]23C[C@@H](C(=O)OC)N(S(=O)(=O)c4c(C)noc4C)C2=NC(C(=O)OC)=C(C(=O)OC)[C@H]13 |
| InChI | InChI=1S/C28H28N4O9S/c1-7-8-13-31-18-12-10-9-11-17(18)28-14-19(24(33)38-4)32(42(36,37)22-15(2)30-41-16(22)3)27(28)29-21(26(35)40-6)20(23(28)31)25(34)39-5/h9-12,19,23H,13-14H2,1-6H3/t19-,23-,28-/m0/s1 |
| InChIKey | LVANDMNWYNUHCP-AMAALNMCSA-N |
| XLogP | 1.39 |
| TPSA | 157.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.62 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|