C27H26N2O6 — CID 16759866
methyl (3aR,4R,7S,11cR)-7-(2-methoxy-2-oxoethyl)-4-methyl-1,3-dioxo-2-phenyl-4,5,7,11c-tetrahydro-3aH-pyrrolo[3,4-a]phenanthridine-6-carboxylate (PubChem CID 16759866) has the molecular formula C27H26N2O6 and a molecular weight of 474.51 g/mol. Its IUPAC name is methyl (3aR,4R,7S,11cR)-7-(2-methoxy-2-oxoethyl)-4-methyl-1,3-dioxo-2-phenyl-4,5,7,11c-tetrahydro-3aH-pyrrolo[3,4-a]phenanthridine-6-carboxylate.
| Compound Name | methyl (3aR,4R,7S,11cR)-7-(2-methoxy-2-oxoethyl)-4-methyl-1,3-dioxo-2-phenyl-4,5,7,11c-tetrahydro-3aH-pyrrolo[3,4-a]phenanthridine-6-carboxylate |
|---|---|
| PubChem CID | 16759866 |
| Molecular Formula | C27H26N2O6 |
| Molecular Weight | 474.51 g/mol |
| Exact Mass | 474.18 |
| IUPAC Name | methyl (3aR,4R,7S,11cR)-7-(2-methoxy-2-oxoethyl)-4-methyl-1,3-dioxo-2-phenyl-4,5,7,11c-tetrahydro-3aH-pyrrolo[3,4-a]phenanthridine-6-carboxylate |
| SMILES | COC(=O)C[C@H]1c2ccccc2C2=C(C[C@@H](C)[C@H]3C(=O)N(c4ccccc4)C(=O)[C@@H]23)N1C(=O)OC |
| InChI | InChI=1S/C27H26N2O6/c1-15-13-20-23(24-22(15)25(31)28(26(24)32)16-9-5-4-6-10-16)18-12-8-7-11-17(18)19(14-21(30)34-2)29(20)27(33)35-3/h4-12,15,19,22,24H,13-14H2,1-3H3/t15-,19+,22-,24-/m1/s1 |
| InChIKey | GKDCPXQLSLEVQI-CSPSMCJWSA-N |
| XLogP | 3.93 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.51 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|