C19H16N4O2 — CID 167598715
4-[[(3-cyano-7-methylquinolin-4-yl)amino]methyl]-N-hydroxybenzamide (PubChem CID 167598715) has the molecular formula C19H16N4O2 and a molecular weight of 332.36 g/mol. Its IUPAC name is 4-[[(3-cyano-7-methylquinolin-4-yl)amino]methyl]-N-hydroxybenzamide.
| Compound Name | 4-[[(3-cyano-7-methylquinolin-4-yl)amino]methyl]-N-hydroxybenzamide |
|---|---|
| PubChem CID | 167598715 |
| Molecular Formula | C19H16N4O2 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | 4-[[(3-cyano-7-methylquinolin-4-yl)amino]methyl]-N-hydroxybenzamide |
| SMILES | Cc1ccc2c(NCc3ccc(C(=O)NO)cc3)c(C#N)cnc2c1 |
| InChI | InChI=1S/C19H16N4O2/c1-12-2-7-16-17(8-12)21-11-15(9-20)18(16)22-10-13-3-5-14(6-4-13)19(24)23-25/h2-8,11,25H,10H2,1H3,(H,21,22)(H,23,24) |
| InChIKey | JKVGFETTWKCPHE-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 98.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|