About methyl 3-heptyl-1-(1-methoxy-1,3-dioxobutan-2-yl)-1H-isoquinoline-2-carboxylate
methyl 3-heptyl-1-(1-methoxy-1,3-dioxobutan-2-yl)-1H-isoquinoline-2-carboxylate (PubChem CID 16759882) has the molecular formula C23H31NO5
and a molecular weight of 401.50 g/mol. Its IUPAC name is methyl 3-heptyl-1-(1-methoxy-1,3-dioxobutan-2-yl)-1H-isoquinoline-2-carboxylate.
Molecular Properties
| Compound Name | methyl 3-heptyl-1-(1-methoxy-1,3-dioxobutan-2-yl)-1H-isoquinoline-2-carboxylate |
| PubChem CID | 16759882 |
| Molecular Formula | C23H31NO5 |
| Molecular Weight | 401.50 g/mol |
| Exact Mass | 401.22 |
| IUPAC Name | methyl 3-heptyl-1-(1-methoxy-1,3-dioxobutan-2-yl)-1H-isoquinoline-2-carboxylate |
| SMILES | CCCCCCCC1=Cc2ccccc2C(C(C(C)=O)C(=O)OC)N1C(=O)OC |
| InChI | InChI=1S/C23H31NO5/c1-5-6-7-8-9-13-18-15-17-12-10-11-14-19(17)21(24(18)23(27)29-4)20(16(2)25)22(26)28-3/h10-12,14-15,20-21H,5-9,13H2,1-4H3 |
| InChIKey | QLPJTBHZONWWNO-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 401.50 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-heptyl-1-(1-methoxy-1,3-dioxobutan-2-yl)-1H-isoquinoline-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-heptyl-1-(1-methoxy-1,3-dioxobutan-2-yl)-1H-isoquinoline-2-carboxylate?
The IUPAC name of methyl 3-heptyl-1-(1-methoxy-1,3-dioxobutan-2-yl)-1H-isoquinoline-2-carboxylate (CID 16759882) is methyl 3-heptyl-1-(1-methoxy-1,3-dioxobutan-2-yl)-1H-isoquinoline-2-carboxylate.
What is the SMILES notation for methyl 3-heptyl-1-(1-methoxy-1,3-dioxobutan-2-yl)-1H-isoquinoline-2-carboxylate?
The canonical SMILES for methyl 3-heptyl-1-(1-methoxy-1,3-dioxobutan-2-yl)-1H-isoquinoline-2-carboxylate is CCCCCCCC1=Cc2ccccc2C(C(C(C)=O)C(=O)OC)N1C(=O)OC.
What is the InChIKey of methyl 3-heptyl-1-(1-methoxy-1,3-dioxobutan-2-yl)-1H-isoquinoline-2-carboxylate?
The InChIKey is QLPJTBHZONWWNO-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H31NO5/c1-5-6-7-8-9-13-18-15-17-12-10-11-14-19(17)21(24(18)23(27)29-4)20(16(2)25)22(26)28-3/h10-12,14-15,20-21H,5-9,13H2,1-4H3.
What are the key properties of methyl 3-heptyl-1-(1-methoxy-1,3-dioxobutan-2-yl)-1H-isoquinoline-2-carboxylate?
methyl 3-heptyl-1-(1-methoxy-1,3-dioxobutan-2-yl)-1H-isoquinoline-2-carboxylate has a molecular weight of 401.50 g/mol, XLogP of 4.89, 9 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-heptyl-1-(1-methoxy-1,3-dioxobutan-2-yl)-1H-isoquinoline-2-carboxylate is sourced from PubChem (CID 16759882), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).