C15H9ClN2O2S — CID 16759933
9-chloro-5H-quinolino[8,7-c][1,2]benzothiazine 6,6-dioxide (PubChem CID 16759933) has the molecular formula C15H9ClN2O2S and a molecular weight of 316.77 g/mol. Its IUPAC name is 9-chloro-5H-quinolino[8,7-c][1,2]benzothiazine 6,6-dioxide.
| Compound Name | 9-chloro-5H-quinolino[8,7-c][1,2]benzothiazine 6,6-dioxide |
|---|---|
| PubChem CID | 16759933 |
| Molecular Formula | C15H9ClN2O2S |
| Molecular Weight | 316.77 g/mol |
| Exact Mass | 316.01 |
| IUPAC Name | 9-chloro-5H-quinolino[8,7-c][1,2]benzothiazine 6,6-dioxide |
| SMILES | O=S1(=O)Nc2c(ccc3cccnc23)-c2cc(Cl)ccc21 |
| InChI | InChI=1S/C15H9ClN2O2S/c16-10-4-6-13-12(8-10)11-5-3-9-2-1-7-17-14(9)15(11)18-21(13,19)20/h1-8,18H |
| InChIKey | JVPPTVNJBXFSPQ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.77 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |