C20H23N2O+ — CID 16760016
(1R,11S,12E,14R,17R)-12-ethylidene-14-methyl-8-aza-14-azoniapentacyclo[9.5.2.01,9.02,7.014,17]octadeca-2,4,6,9-tetraene-10-carbaldehyde (PubChem CID 16760016) has the molecular formula C20H23N2O+ and a molecular weight of 307.42 g/mol. Its IUPAC name is (1R,11S,12E,14R,17R)-12-ethylidene-14-methyl-8-aza-14-azoniapentacyclo[9.5.2.01,9.02,7.014,17]octadeca-2,4,6,9-tetraene-10-carbaldehyde.
| Compound Name | (1R,11S,12E,14R,17R)-12-ethylidene-14-methyl-8-aza-14-azoniapentacyclo[9.5.2.01,9.02,7.014,17]octadeca-2,4,6,9-tetraene-10-carbaldehyde |
|---|---|
| PubChem CID | 16760016 |
| Molecular Formula | C20H23N2O+ |
| Molecular Weight | 307.42 g/mol |
| Exact Mass | 307.18 |
| IUPAC Name | (1R,11S,12E,14R,17R)-12-ethylidene-14-methyl-8-aza-14-azoniapentacyclo[9.5.2.01,9.02,7.014,17]octadeca-2,4,6,9-tetraene-10-carbaldehyde |
| SMILES | C/C=C1/C[N@@+]2(C)CC[C@]34C(=C(C=O)[C@H]1C[C@H]32)Nc1ccccc14 |
| InChI | InChI=1S/C20H22N2O/c1-3-13-11-22(2)9-8-20-16-6-4-5-7-17(16)21-19(20)15(12-23)14(13)10-18(20)22/h3-7,12,14,18H,8-11H2,1-2H3/p+1/b13-3-/t14-,18+,20+,22+/m0/s1 |
| InChIKey | ZEMNDQUOMWGCAZ-GHWIUQFXSA-O |
| XLogP | 3.00 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.42 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|