C8H4N4O6 — CID 16760018
5,7-dinitro-1,4-dihydroquinoxaline-2,3-dione (PubChem CID 16760018) has the molecular formula C8H4N4O6 and a molecular weight of 252.14 g/mol. Its IUPAC name is 5,7-dinitro-1,4-dihydroquinoxaline-2,3-dione.
| Compound Name | 5,7-dinitro-1,4-dihydroquinoxaline-2,3-dione |
|---|---|
| PubChem CID | 16760018 |
| Molecular Formula | C8H4N4O6 |
| Molecular Weight | 252.14 g/mol |
| Exact Mass | 252.01 |
| IUPAC Name | 5,7-dinitro-1,4-dihydroquinoxaline-2,3-dione |
| SMILES | O=c1[nH]c2cc([N+](=O)[O-])cc([N+](=O)[O-])c2[nH]c1=O |
| InChI | InChI=1S/C8H4N4O6/c13-7-8(14)10-6-4(9-7)1-3(11(15)16)2-5(6)12(17)18/h1-2H,(H,9,13)(H,10,14) |
| InChIKey | YUVRBZPHIDJESL-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 152.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.14 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|