C14H13N5O3 — CID 167600605
4-amino-6-[(6-methoxy-1H-isoindol-5-yl)amino]pyrimidine-5-carboxylic acid (PubChem CID 167600605) has the molecular formula C14H13N5O3 and a molecular weight of 299.29 g/mol. Its IUPAC name is 4-amino-6-[(6-methoxy-1H-isoindol-5-yl)amino]pyrimidine-5-carboxylic acid.
| Compound Name | 4-amino-6-[(6-methoxy-1H-isoindol-5-yl)amino]pyrimidine-5-carboxylic acid |
|---|---|
| PubChem CID | 167600605 |
| Molecular Formula | C14H13N5O3 |
| Molecular Weight | 299.29 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | 4-amino-6-[(6-methoxy-1H-isoindol-5-yl)amino]pyrimidine-5-carboxylic acid |
| SMILES | COc1cc2c(cc1Nc1ncnc(N)c1C(=O)O)C=NC2 |
| InChI | InChI=1S/C14H13N5O3/c1-22-10-3-8-5-16-4-7(8)2-9(10)19-13-11(14(20)21)12(15)17-6-18-13/h2-4,6H,5H2,1H3,(H,20,21)(H3,15,17,18,19) |
| InChIKey | HTRSFYPZGAJMRI-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 122.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.29 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |