C23H18F3NO4S — CID 167601334
4-cyclopropyl-3-[[2-pyridin-2-yl-5-(trifluoromethyl)phenyl]methylsulfonyl]benzoic acid (PubChem CID 167601334) has the molecular formula C23H18F3NO4S and a molecular weight of 461.46 g/mol. Its IUPAC name is 4-cyclopropyl-3-[[2-pyridin-2-yl-5-(trifluoromethyl)phenyl]methylsulfonyl]benzoic acid.
| Compound Name | 4-cyclopropyl-3-[[2-pyridin-2-yl-5-(trifluoromethyl)phenyl]methylsulfonyl]benzoic acid |
|---|---|
| PubChem CID | 167601334 |
| Molecular Formula | C23H18F3NO4S |
| Molecular Weight | 461.46 g/mol |
| Exact Mass | 461.09 |
| IUPAC Name | 4-cyclopropyl-3-[[2-pyridin-2-yl-5-(trifluoromethyl)phenyl]methylsulfonyl]benzoic acid |
| SMILES | O=C(O)c1ccc(C2CC2)c(S(=O)(=O)Cc2cc(C(F)(F)F)ccc2-c2ccccn2)c1 |
| InChI | InChI=1S/C23H18F3NO4S/c24-23(25,26)17-7-9-18(20-3-1-2-10-27-20)16(11-17)13-32(30,31)21-12-15(22(28)29)6-8-19(21)14-4-5-14/h1-3,6-12,14H,4-5,13H2,(H,28,29) |
| InChIKey | MTQVWGOGYVBZAF-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 84.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.46 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |