About (1-thieno[3,2-b]pyridin-7-ylpyrrolidin-3-yl) 2-(4-phenoxyphenyl)acetate
(1-thieno[3,2-b]pyridin-7-ylpyrrolidin-3-yl) 2-(4-phenoxyphenyl)acetate (PubChem CID 167602342) has the molecular formula C25H22N2O3S
and a molecular weight of 430.53 g/mol. Its IUPAC name is (1-thieno[3,2-b]pyridin-7-ylpyrrolidin-3-yl) 2-(4-phenoxyphenyl)acetate.
Molecular Properties
| Compound Name | (1-thieno[3,2-b]pyridin-7-ylpyrrolidin-3-yl) 2-(4-phenoxyphenyl)acetate |
| PubChem CID | 167602342 |
| Molecular Formula | C25H22N2O3S |
| Molecular Weight | 430.53 g/mol |
| Exact Mass | 430.14 |
| IUPAC Name | (1-thieno[3,2-b]pyridin-7-ylpyrrolidin-3-yl) 2-(4-phenoxyphenyl)acetate |
| SMILES | O=C(Cc1ccc(Oc2ccccc2)cc1)OC1CCN(c2ccnc3ccsc23)C1 |
| InChI | InChI=1S/C25H22N2O3S/c28-24(16-18-6-8-20(9-7-18)29-19-4-2-1-3-5-19)30-21-11-14-27(17-21)23-10-13-26-22-12-15-31-25(22)23/h1-10,12-13,15,21H,11,14,16-17H2 |
| InChIKey | RYYUDCABQRDUKX-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 430.53 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (1-thieno[3,2-b]pyridin-7-ylpyrrolidin-3-yl) 2-(4-phenoxyphenyl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-thieno[3,2-b]pyridin-7-ylpyrrolidin-3-yl) 2-(4-phenoxyphenyl)acetate?
The IUPAC name of (1-thieno[3,2-b]pyridin-7-ylpyrrolidin-3-yl) 2-(4-phenoxyphenyl)acetate (CID 167602342) is (1-thieno[3,2-b]pyridin-7-ylpyrrolidin-3-yl) 2-(4-phenoxyphenyl)acetate.
What is the SMILES notation for (1-thieno[3,2-b]pyridin-7-ylpyrrolidin-3-yl) 2-(4-phenoxyphenyl)acetate?
The canonical SMILES for (1-thieno[3,2-b]pyridin-7-ylpyrrolidin-3-yl) 2-(4-phenoxyphenyl)acetate is O=C(Cc1ccc(Oc2ccccc2)cc1)OC1CCN(c2ccnc3ccsc23)C1.
What is the InChIKey of (1-thieno[3,2-b]pyridin-7-ylpyrrolidin-3-yl) 2-(4-phenoxyphenyl)acetate?
The InChIKey is RYYUDCABQRDUKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H22N2O3S/c28-24(16-18-6-8-20(9-7-18)29-19-4-2-1-3-5-19)30-21-11-14-27(17-21)23-10-13-26-22-12-15-31-25(22)23/h1-10,12-13,15,21H,11,14,16-17H2.
What are the key properties of (1-thieno[3,2-b]pyridin-7-ylpyrrolidin-3-yl) 2-(4-phenoxyphenyl)acetate?
(1-thieno[3,2-b]pyridin-7-ylpyrrolidin-3-yl) 2-(4-phenoxyphenyl)acetate has a molecular weight of 430.53 g/mol, XLogP of 5.45, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (1-thieno[3,2-b]pyridin-7-ylpyrrolidin-3-yl) 2-(4-phenoxyphenyl)acetate is sourced from PubChem (CID 167602342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).