C14H20N4O2S — CID 167603336
6-methanimidoyl-2,4-dimethyl-N-(2-propoxyethyl)pyrrolo[2,3-d][1,3]thiazole-5-carboxamide (PubChem CID 167603336) has the molecular formula C14H20N4O2S and a molecular weight of 308.41 g/mol. Its IUPAC name is 6-methanimidoyl-2,4-dimethyl-N-(2-propoxyethyl)pyrrolo[2,3-d][1,3]thiazole-5-carboxamide.
| Compound Name | 6-methanimidoyl-2,4-dimethyl-N-(2-propoxyethyl)pyrrolo[2,3-d][1,3]thiazole-5-carboxamide |
|---|---|
| PubChem CID | 167603336 |
| Molecular Formula | C14H20N4O2S |
| Molecular Weight | 308.41 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | 6-methanimidoyl-2,4-dimethyl-N-(2-propoxyethyl)pyrrolo[2,3-d][1,3]thiazole-5-carboxamide |
| SMILES | [H]/N=C/c1c(C(=O)NCCOCCC)n(C)c2nc(C)sc12 |
| InChI | InChI=1S/C14H20N4O2S/c1-4-6-20-7-5-16-14(19)11-10(8-15)12-13(18(11)3)17-9(2)21-12/h8,15H,4-7H2,1-3H3,(H,16,19)/b15-8+ |
| InChIKey | KAQGBQRPCDYOSN-OVCLIPMQSA-N |
| XLogP | 2.10 |
| TPSA | 80.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.41 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|