About tert-butyl 2-(7-methyl-5-oxospiro[7H-pyrano[4,3-b]pyridine-8,1'-cyclopropane]-2-yl)acetate
tert-butyl 2-(7-methyl-5-oxospiro[7H-pyrano[4,3-b]pyridine-8,1'-cyclopropane]-2-yl)acetate (PubChem CID 167603538) has the molecular formula C17H21NO4
and a molecular weight of 303.36 g/mol. Its IUPAC name is tert-butyl 2-(7-methyl-5-oxospiro[7H-pyrano[4,3-b]pyridine-8,1'-cyclopropane]-2-yl)acetate.
Molecular Properties
| Compound Name | tert-butyl 2-(7-methyl-5-oxospiro[7H-pyrano[4,3-b]pyridine-8,1'-cyclopropane]-2-yl)acetate |
| PubChem CID | 167603538 |
| Molecular Formula | C17H21NO4 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | tert-butyl 2-(7-methyl-5-oxospiro[7H-pyrano[4,3-b]pyridine-8,1'-cyclopropane]-2-yl)acetate |
| SMILES | CC1OC(=O)c2ccc(CC(=O)OC(C)(C)C)nc2C12CC2 |
| InChI | InChI=1S/C17H21NO4/c1-10-17(7-8-17)14-12(15(20)21-10)6-5-11(18-14)9-13(19)22-16(2,3)4/h5-6,10H,7-9H2,1-4H3 |
| InChIKey | NDCMRCUQYGFXGO-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze tert-butyl 2-(7-methyl-5-oxospiro[7H-pyrano[4,3-b]pyridine-8,1'-cyclopropane]-2-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2-(7-methyl-5-oxospiro[7H-pyrano[4,3-b]pyridine-8,1'-cyclopropane]-2-yl)acetate?
The IUPAC name of tert-butyl 2-(7-methyl-5-oxospiro[7H-pyrano[4,3-b]pyridine-8,1'-cyclopropane]-2-yl)acetate (CID 167603538) is tert-butyl 2-(7-methyl-5-oxospiro[7H-pyrano[4,3-b]pyridine-8,1'-cyclopropane]-2-yl)acetate.
What is the SMILES notation for tert-butyl 2-(7-methyl-5-oxospiro[7H-pyrano[4,3-b]pyridine-8,1'-cyclopropane]-2-yl)acetate?
The canonical SMILES for tert-butyl 2-(7-methyl-5-oxospiro[7H-pyrano[4,3-b]pyridine-8,1'-cyclopropane]-2-yl)acetate is CC1OC(=O)c2ccc(CC(=O)OC(C)(C)C)nc2C12CC2.
What is the InChIKey of tert-butyl 2-(7-methyl-5-oxospiro[7H-pyrano[4,3-b]pyridine-8,1'-cyclopropane]-2-yl)acetate?
The InChIKey is NDCMRCUQYGFXGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21NO4/c1-10-17(7-8-17)14-12(15(20)21-10)6-5-11(18-14)9-13(19)22-16(2,3)4/h5-6,10H,7-9H2,1-4H3.
What are the key properties of tert-butyl 2-(7-methyl-5-oxospiro[7H-pyrano[4,3-b]pyridine-8,1'-cyclopropane]-2-yl)acetate?
tert-butyl 2-(7-methyl-5-oxospiro[7H-pyrano[4,3-b]pyridine-8,1'-cyclopropane]-2-yl)acetate has a molecular weight of 303.36 g/mol, XLogP of 2.56, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-(7-methyl-5-oxospiro[7H-pyrano[4,3-b]pyridine-8,1'-cyclopropane]-2-yl)acetate is sourced from PubChem (CID 167603538), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).