About 2-[bis[2-(2,6-dioxomorpholin-4-yl)ethyl]azaniumyl]acetate
2-[bis[2-(2,6-dioxomorpholin-4-yl)ethyl]azaniumyl]acetate (PubChem CID 16760401) has the molecular formula C14H19N3O8
and a molecular weight of 357.32 g/mol. Its IUPAC name is 2-[bis[2-(2,6-dioxomorpholin-4-yl)ethyl]azaniumyl]acetate.
Molecular Properties
| Compound Name | 2-[bis[2-(2,6-dioxomorpholin-4-yl)ethyl]azaniumyl]acetate |
| PubChem CID | 16760401 |
| Molecular Formula | C14H19N3O8 |
| Molecular Weight | 357.32 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | 2-[bis[2-(2,6-dioxomorpholin-4-yl)ethyl]azaniumyl]acetate |
| SMILES | O=C([O-])C[NH+](CCN1CC(=O)OC(=O)C1)CCN1CC(=O)OC(=O)C1 |
| InChI | InChI=1S/C14H19N3O8/c18-10(19)5-15(1-3-16-6-11(20)24-12(21)7-16)2-4-17-8-13(22)25-14(23)9-17/h1-9H2,(H,18,19) |
| InChIKey | RAZLJUXJEOEYAM-UHFFFAOYSA-N |
| XLogP | -5.61 |
| TPSA | 137.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.32 |
| LogP ≤ 5 | -5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 2-[bis[2-(2,6-dioxomorpholin-4-yl)ethyl]azaniumyl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[bis[2-(2,6-dioxomorpholin-4-yl)ethyl]azaniumyl]acetate?
The IUPAC name of 2-[bis[2-(2,6-dioxomorpholin-4-yl)ethyl]azaniumyl]acetate (CID 16760401) is 2-[bis[2-(2,6-dioxomorpholin-4-yl)ethyl]azaniumyl]acetate.
What is the SMILES notation for 2-[bis[2-(2,6-dioxomorpholin-4-yl)ethyl]azaniumyl]acetate?
The canonical SMILES for 2-[bis[2-(2,6-dioxomorpholin-4-yl)ethyl]azaniumyl]acetate is O=C([O-])C[NH+](CCN1CC(=O)OC(=O)C1)CCN1CC(=O)OC(=O)C1.
What is the InChIKey of 2-[bis[2-(2,6-dioxomorpholin-4-yl)ethyl]azaniumyl]acetate?
The InChIKey is RAZLJUXJEOEYAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19N3O8/c18-10(19)5-15(1-3-16-6-11(20)24-12(21)7-16)2-4-17-8-13(22)25-14(23)9-17/h1-9H2,(H,18,19).
What are the key properties of 2-[bis[2-(2,6-dioxomorpholin-4-yl)ethyl]azaniumyl]acetate?
2-[bis[2-(2,6-dioxomorpholin-4-yl)ethyl]azaniumyl]acetate has a molecular weight of 357.32 g/mol, XLogP of -5.61, 8 rotatable bonds, 1 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[bis[2-(2,6-dioxomorpholin-4-yl)ethyl]azaniumyl]acetate is sourced from PubChem (CID 16760401), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).