C39H47N5O6 — CID 167604730
6-cyclohexyl-3H-1,3-benzoxazol-2-one;6-(2,2-dimethylpiperidin-4-yl)-3H-1,3-benzoxazol-2-one;6-piperidin-4-yl-3H-1,3-benzoxazol-2-one (PubChem CID 167604730) has the molecular formula C39H47N5O6 and a molecular weight of 681.83 g/mol. Its IUPAC name is 6-cyclohexyl-3H-1,3-benzoxazol-2-one;6-(2,2-dimethylpiperidin-4-yl)-3H-1,3-benzoxazol-2-one;6-piperidin-4-yl-3H-1,3-benzoxazol-2-one.
| Compound Name | 6-cyclohexyl-3H-1,3-benzoxazol-2-one;6-(2,2-dimethylpiperidin-4-yl)-3H-1,3-benzoxazol-2-one;6-piperidin-4-yl-3H-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 167604730 |
| Molecular Formula | C39H47N5O6 |
| Molecular Weight | 681.83 g/mol |
| Exact Mass | 681.35 |
| IUPAC Name | 6-cyclohexyl-3H-1,3-benzoxazol-2-one;6-(2,2-dimethylpiperidin-4-yl)-3H-1,3-benzoxazol-2-one;6-piperidin-4-yl-3H-1,3-benzoxazol-2-one |
| SMILES | CC1(C)CC(c2ccc3[nH]c(=O)oc3c2)CCN1.O=c1[nH]c2ccc(C3CCCCC3)cc2o1.O=c1[nH]c2ccc(C3CCNCC3)cc2o1 |
| InChI | InChI=1S/C14H18N2O2.C13H15NO2.C12H14N2O2/c1-14(2)8-10(5-6-15-14)9-3-4-11-12(7-9)18-13(17)16-11;15-13-14-11-7-6-10(8-12(11)16-13)9-4-2-1-3-5-9;15-12-14-10-2-1-9(7-11(10)16-12)8-3-5-13-6-4-8/h3-4,7,10,15H,5-6,8H2,1-2H3,(H,16,17);6-9H,1-5H2,(H,14,15);1-2,7-8,13H,3-6H2,(H,14,15) |
| InChIKey | KFLWXHFYXABPBE-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 162.06 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.83 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |