C22H18F2N4O3 — CID 167604776
2-[6-(2,4-difluorophenyl)-3-nitro-2-pyridinyl]-1-(6-ethyl-1,3-dihydropyrrolo[3,4-c]pyridin-2-yl)ethanone (PubChem CID 167604776) has the molecular formula C22H18F2N4O3 and a molecular weight of 424.41 g/mol. Its IUPAC name is 2-[6-(2,4-difluorophenyl)-3-nitro-2-pyridinyl]-1-(6-ethyl-1,3-dihydropyrrolo[3,4-c]pyridin-2-yl)ethanone.
| Compound Name | 2-[6-(2,4-difluorophenyl)-3-nitro-2-pyridinyl]-1-(6-ethyl-1,3-dihydropyrrolo[3,4-c]pyridin-2-yl)ethanone |
|---|---|
| PubChem CID | 167604776 |
| Molecular Formula | C22H18F2N4O3 |
| Molecular Weight | 424.41 g/mol |
| Exact Mass | 424.13 |
| IUPAC Name | 2-[6-(2,4-difluorophenyl)-3-nitro-2-pyridinyl]-1-(6-ethyl-1,3-dihydropyrrolo[3,4-c]pyridin-2-yl)ethanone |
| SMILES | CCc1cc2c(cn1)CN(C(=O)Cc1nc(-c3ccc(F)cc3F)ccc1[N+](=O)[O-])C2 |
| InChI | InChI=1S/C22H18F2N4O3/c1-2-16-7-13-11-27(12-14(13)10-25-16)22(29)9-20-21(28(30)31)6-5-19(26-20)17-4-3-15(23)8-18(17)24/h3-8,10H,2,9,11-12H2,1H3 |
| InChIKey | SEJBCMMMABFCIW-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 89.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.41 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|