C23H24N2O5Si — CID 167605154
(19S)-19-ethyl-7,19-dihydroxy-10-[hydroxy(dimethyl)silyl]-18-methylidene-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaen-14-one (PubChem CID 167605154) has the molecular formula C23H24N2O5Si and a molecular weight of 436.54 g/mol. Its IUPAC name is (19S)-19-ethyl-7,19-dihydroxy-10-[hydroxy(dimethyl)silyl]-18-methylidene-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaen-14-one.
| Compound Name | (19S)-19-ethyl-7,19-dihydroxy-10-[hydroxy(dimethyl)silyl]-18-methylidene-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaen-14-one |
|---|---|
| PubChem CID | 167605154 |
| Molecular Formula | C23H24N2O5Si |
| Molecular Weight | 436.54 g/mol |
| Exact Mass | 436.15 |
| IUPAC Name | (19S)-19-ethyl-7,19-dihydroxy-10-[hydroxy(dimethyl)silyl]-18-methylidene-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaen-14-one |
| SMILES | C=C1OCc2c(cc3n(c2=O)Cc2c-3nc3ccc(O)cc3c2[Si](C)(C)O)[C@@]1(O)CC |
| InChI | InChI=1S/C23H24N2O5Si/c1-5-23(28)12(2)30-11-16-17(23)9-19-20-15(10-25(19)22(16)27)21(31(3,4)29)14-8-13(26)6-7-18(14)24-20/h6-9,26,28-29H,2,5,10-11H2,1,3-4H3/t23-/m1/s1 |
| InChIKey | HEIWPJWCBIUMSE-HSZRJFAPSA-N |
| XLogP | 2.18 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.54 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|