C20H30N2 — CID 167605728
(1S,5R)-3-ethynyl-2-propan-2-yl-3-azabicyclo[3.1.0]hexane (PubChem CID 167605728) has the molecular formula C20H30N2 and a molecular weight of 298.47 g/mol. Its IUPAC name is (1S,5R)-3-ethynyl-2-propan-2-yl-3-azabicyclo[3.1.0]hexane.
| Compound Name | (1S,5R)-3-ethynyl-2-propan-2-yl-3-azabicyclo[3.1.0]hexane |
|---|---|
| PubChem CID | 167605728 |
| Molecular Formula | C20H30N2 |
| Molecular Weight | 298.47 g/mol |
| Exact Mass | 298.24 |
| IUPAC Name | (1S,5R)-3-ethynyl-2-propan-2-yl-3-azabicyclo[3.1.0]hexane |
| SMILES | C#CN1C[C@@H]2C[C@@H]2C1C(C)C.C#CN1C[C@@H]2C[C@@H]2C1C(C)C |
| InChI | InChI=1S/2C10H15N/c2*1-4-11-6-8-5-9(8)10(11)7(2)3/h2*1,7-10H,5-6H2,2-3H3/t2*8-,9-,10?/m00/s1 |
| InChIKey | KIVLBEXVQOOOOH-AOLIAEROSA-N |
| XLogP | 3.11 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.47 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|