C21H38F5NO6Si5 — CID 167606074
N-[3-[dimethyl-[2-(2,4,6,8-tetramethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl)ethyl]silyl]propyl]-2,3,3,3-tetrafluoro-2-(fluoromethoxy)-N-phenylpropanamide (PubChem CID 167606074) has the molecular formula C21H38F5NO6Si5 and a molecular weight of 635.96 g/mol. Its IUPAC name is N-[3-[dimethyl-[2-(2,4,6,8-tetramethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl)ethyl]silyl]propyl]-2,3,3,3-tetrafluoro-2-(fluoromethoxy)-N-phenylpropanamide.
| Compound Name | N-[3-[dimethyl-[2-(2,4,6,8-tetramethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl)ethyl]silyl]propyl]-2,3,3,3-tetrafluoro-2-(fluoromethoxy)-N-phenylpropanamide |
|---|---|
| PubChem CID | 167606074 |
| Molecular Formula | C21H38F5NO6Si5 |
| Molecular Weight | 635.96 g/mol |
| Exact Mass | 635.15 |
| IUPAC Name | N-[3-[dimethyl-[2-(2,4,6,8-tetramethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl)ethyl]silyl]propyl]-2,3,3,3-tetrafluoro-2-(fluoromethoxy)-N-phenylpropanamide |
| SMILES | C[SiH]1O[SiH](C)O[Si](C)(CC[Si](C)(C)CCCN(C(=O)C(F)(OCF)C(F)(F)F)c2ccccc2)O[SiH](C)O1 |
| InChI | InChI=1S/C21H38F5NO6Si5/c1-34-30-35(2)32-38(6,33-36(3)31-34)16-15-37(4,5)14-10-13-27(18-11-8-7-9-12-18)19(28)20(23,29-17-22)21(24,25)26/h7-9,11-12,34-36H,10,13-17H2,1-6H3 |
| InChIKey | GGCZCRWYJZRHBE-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 66.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.96 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|