C31H36N6O4 — CID 167606582
1-[4-(2-morpholin-4-ylethoxymethyl)phenyl]-3-[4-(6-morpholin-4-yl-7H-purin-2-yl)phenyl]propan-2-one (PubChem CID 167606582) has the molecular formula C31H36N6O4 and a molecular weight of 556.67 g/mol. Its IUPAC name is 1-[4-(2-morpholin-4-ylethoxymethyl)phenyl]-3-[4-(6-morpholin-4-yl-7H-purin-2-yl)phenyl]propan-2-one.
| Compound Name | 1-[4-(2-morpholin-4-ylethoxymethyl)phenyl]-3-[4-(6-morpholin-4-yl-7H-purin-2-yl)phenyl]propan-2-one |
|---|---|
| PubChem CID | 167606582 |
| Molecular Formula | C31H36N6O4 |
| Molecular Weight | 556.67 g/mol |
| Exact Mass | 556.28 |
| IUPAC Name | 1-[4-(2-morpholin-4-ylethoxymethyl)phenyl]-3-[4-(6-morpholin-4-yl-7H-purin-2-yl)phenyl]propan-2-one |
| SMILES | O=C(Cc1ccc(COCCN2CCOCC2)cc1)Cc1ccc(-c2nc(N3CCOCC3)c3[nH]cnc3n2)cc1 |
| InChI | InChI=1S/C31H36N6O4/c38-27(19-23-1-3-25(4-2-23)21-41-16-11-36-9-14-39-15-10-36)20-24-5-7-26(8-6-24)29-34-30-28(32-22-33-30)31(35-29)37-12-17-40-18-13-37/h1-8,22H,9-21H2,(H,32,33,34,35) |
| InChIKey | UWOKGCQCIDZUOB-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 105.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.67 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|