C15H27BF6N6O10S — CID 167606781
(3R,4S)-3-amino-4-(3-boronopropyl)-1-[2-(diaminomethylideneamino)ethylsulfamoyl]pyrrolidine-3-carboxylic acid;bis(2,2,2-trifluoroacetic acid) (PubChem CID 167606781) has the molecular formula C15H27BF6N6O10S and a molecular weight of 608.28 g/mol. Its IUPAC name is (3R,4S)-3-amino-4-(3-boronopropyl)-1-[2-(diaminomethylideneamino)ethylsulfamoyl]pyrrolidine-3-carboxylic acid;bis(2,2,2-trifluoroacetic acid).
| Compound Name | (3R,4S)-3-amino-4-(3-boronopropyl)-1-[2-(diaminomethylideneamino)ethylsulfamoyl]pyrrolidine-3-carboxylic acid;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 167606781 |
| Molecular Formula | C15H27BF6N6O10S |
| Molecular Weight | 608.28 g/mol |
| Exact Mass | 608.15 |
| IUPAC Name | (3R,4S)-3-amino-4-(3-boronopropyl)-1-[2-(diaminomethylideneamino)ethylsulfamoyl]pyrrolidine-3-carboxylic acid;bis(2,2,2-trifluoroacetic acid) |
| SMILES | NC(N)=NCCNS(=O)(=O)N1C[C@H](CCCB(O)O)[C@](N)(C(=O)O)C1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C11H25BN6O6S.2C2HF3O2/c13-10(14)16-4-5-17-25(23,24)18-6-8(2-1-3-12(21)22)11(15,7-18)9(19)20;2*3-2(4,5)1(6)7/h8,17,21-22H,1-7,15H2,(H,19,20)(H4,13,14,16);2*(H,6,7)/t8-,11-;;/m0../s1 |
| InChIKey | VDMRYMOHJIBHIH-QSOAFRDGSA-N |
| XLogP | -2.67 |
| TPSA | 292.19 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.28 |
| LogP ≤ 5 | -2.67 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|