C18H32F6O9 — CID 167607999
1-[2-[2-[[1,1-difluoro-2-[2-hydroxy-3-(4-hydroxybutoxy)propoxy]ethoxy]-difluoromethoxy]-2,2-difluoroethoxy]ethoxy]butan-2-ol (PubChem CID 167607999) has the molecular formula C18H32F6O9 and a molecular weight of 506.43 g/mol. Its IUPAC name is 1-[2-[2-[[1,1-difluoro-2-[2-hydroxy-3-(4-hydroxybutoxy)propoxy]ethoxy]-difluoromethoxy]-2,2-difluoroethoxy]ethoxy]butan-2-ol.
| Compound Name | 1-[2-[2-[[1,1-difluoro-2-[2-hydroxy-3-(4-hydroxybutoxy)propoxy]ethoxy]-difluoromethoxy]-2,2-difluoroethoxy]ethoxy]butan-2-ol |
|---|---|
| PubChem CID | 167607999 |
| Molecular Formula | C18H32F6O9 |
| Molecular Weight | 506.43 g/mol |
| Exact Mass | 506.20 |
| IUPAC Name | 1-[2-[2-[[1,1-difluoro-2-[2-hydroxy-3-(4-hydroxybutoxy)propoxy]ethoxy]-difluoromethoxy]-2,2-difluoroethoxy]ethoxy]butan-2-ol |
| SMILES | CCC(O)COCCOCC(F)(F)OC(F)(F)OC(F)(F)COCC(O)COCCCCO |
| InChI | InChI=1S/C18H32F6O9/c1-2-14(26)9-29-7-8-30-12-16(19,20)32-18(23,24)33-17(21,22)13-31-11-15(27)10-28-6-4-3-5-25/h14-15,25-27H,2-13H2,1H3 |
| InChIKey | HQEFENWETNCGGZ-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 116.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.43 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|