C23H29Cl2F2NO4S — CID 167608327
N-[3-[4-[2-(4-butoxy-3,5-dichlorophenyl)propan-2-yl]phenoxy]-3,3-difluoropropyl]methanesulfonamide (PubChem CID 167608327) has the molecular formula C23H29Cl2F2NO4S and a molecular weight of 524.46 g/mol. Its IUPAC name is N-[3-[4-[2-(4-butoxy-3,5-dichlorophenyl)propan-2-yl]phenoxy]-3,3-difluoropropyl]methanesulfonamide.
| Compound Name | N-[3-[4-[2-(4-butoxy-3,5-dichlorophenyl)propan-2-yl]phenoxy]-3,3-difluoropropyl]methanesulfonamide |
|---|---|
| PubChem CID | 167608327 |
| Molecular Formula | C23H29Cl2F2NO4S |
| Molecular Weight | 524.46 g/mol |
| Exact Mass | 523.12 |
| IUPAC Name | N-[3-[4-[2-(4-butoxy-3,5-dichlorophenyl)propan-2-yl]phenoxy]-3,3-difluoropropyl]methanesulfonamide |
| SMILES | CCCCOc1c(Cl)cc(C(C)(C)c2ccc(OC(F)(F)CCNS(C)(=O)=O)cc2)cc1Cl |
| InChI | InChI=1S/C23H29Cl2F2NO4S/c1-5-6-13-31-21-19(24)14-17(15-20(21)25)22(2,3)16-7-9-18(10-8-16)32-23(26,27)11-12-28-33(4,29)30/h7-10,14-15,28H,5-6,11-13H2,1-4H3 |
| InChIKey | BOZCANPBUJKBGK-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.46 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|