About [(Z)-[(2Z)-2-acetyloxyimino-1,2-bis(3,5-dimethylpyrazol-1-yl)ethylidene]amino] acetate
[(Z)-[(2Z)-2-acetyloxyimino-1,2-bis(3,5-dimethylpyrazol-1-yl)ethylidene]amino] acetate (PubChem CID 16760866) has the molecular formula C16H20N6O4
and a molecular weight of 360.37 g/mol. Its IUPAC name is [(Z)-[(2Z)-2-acetyloxyimino-1,2-bis(3,5-dimethylpyrazol-1-yl)ethylidene]amino] acetate.
Molecular Properties
| Compound Name | [(Z)-[(2Z)-2-acetyloxyimino-1,2-bis(3,5-dimethylpyrazol-1-yl)ethylidene]amino] acetate |
| PubChem CID | 16760866 |
| Molecular Formula | C16H20N6O4 |
| Molecular Weight | 360.37 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | [(Z)-[(2Z)-2-acetyloxyimino-1,2-bis(3,5-dimethylpyrazol-1-yl)ethylidene]amino] acetate |
| SMILES | CC(=O)O/N=C(C(=N/OC(C)=O)/n1nc(C)cc1C)\n1nc(C)cc1C |
| InChI | InChI=1S/C16H20N6O4/c1-9-7-11(3)21(17-9)15(19-25-13(5)23)16(20-26-14(6)24)22-12(4)8-10(2)18-22/h7-8H,1-6H3/b19-15-,20-16- |
| InChIKey | SYCDKWSJUMYCCJ-IKBKFCNISA-N |
| XLogP | 1.46 |
| TPSA | 112.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.37 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(Z)-[(2Z)-2-acetyloxyimino-1,2-bis(3,5-dimethylpyrazol-1-yl)ethylidene]amino] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z)-[(2Z)-2-acetyloxyimino-1,2-bis(3,5-dimethylpyrazol-1-yl)ethylidene]amino] acetate?
The IUPAC name of [(Z)-[(2Z)-2-acetyloxyimino-1,2-bis(3,5-dimethylpyrazol-1-yl)ethylidene]amino] acetate (CID 16760866) is [(Z)-[(2Z)-2-acetyloxyimino-1,2-bis(3,5-dimethylpyrazol-1-yl)ethylidene]amino] acetate.
What is the SMILES notation for [(Z)-[(2Z)-2-acetyloxyimino-1,2-bis(3,5-dimethylpyrazol-1-yl)ethylidene]amino] acetate?
The canonical SMILES for [(Z)-[(2Z)-2-acetyloxyimino-1,2-bis(3,5-dimethylpyrazol-1-yl)ethylidene]amino] acetate is CC(=O)O/N=C(C(=N/OC(C)=O)/n1nc(C)cc1C)\n1nc(C)cc1C.
What is the InChIKey of [(Z)-[(2Z)-2-acetyloxyimino-1,2-bis(3,5-dimethylpyrazol-1-yl)ethylidene]amino] acetate?
The InChIKey is SYCDKWSJUMYCCJ-IKBKFCNISA-N. The full InChI is InChI=1S/C16H20N6O4/c1-9-7-11(3)21(17-9)15(19-25-13(5)23)16(20-26-14(6)24)22-12(4)8-10(2)18-22/h7-8H,1-6H3/b19-15-,20-16-.
What are the key properties of [(Z)-[(2Z)-2-acetyloxyimino-1,2-bis(3,5-dimethylpyrazol-1-yl)ethylidene]amino] acetate?
[(Z)-[(2Z)-2-acetyloxyimino-1,2-bis(3,5-dimethylpyrazol-1-yl)ethylidene]amino] acetate has a molecular weight of 360.37 g/mol, XLogP of 1.46, 2 rotatable bonds, 0 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z)-[(2Z)-2-acetyloxyimino-1,2-bis(3,5-dimethylpyrazol-1-yl)ethylidene]amino] acetate is sourced from PubChem (CID 16760866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).