C29H37F2NO2 — CID 167609098
(1S,3aS,3bS,5aR,9aR,9bS,11aS)-1-[2-[2-(1,1-difluoroethyl)phenyl]acetyl]-6,9a,11a-trimethyl-2,3,3a,3b,4,5,5a,9b,10,11-decahydro-1H-indeno[5,4-f]quinolin-7-one (PubChem CID 167609098) has the molecular formula C29H37F2NO2 and a molecular weight of 469.62 g/mol. Its IUPAC name is (1S,3aS,3bS,5aR,9aR,9bS,11aS)-1-[2-[2-(1,1-difluoroethyl)phenyl]acetyl]-6,9a,11a-trimethyl-2,3,3a,3b,4,5,5a,9b,10,11-decahydro-1H-indeno[5,4-f]quinolin-7-one.
| Compound Name | (1S,3aS,3bS,5aR,9aR,9bS,11aS)-1-[2-[2-(1,1-difluoroethyl)phenyl]acetyl]-6,9a,11a-trimethyl-2,3,3a,3b,4,5,5a,9b,10,11-decahydro-1H-indeno[5,4-f]quinolin-7-one |
|---|---|
| PubChem CID | 167609098 |
| Molecular Formula | C29H37F2NO2 |
| Molecular Weight | 469.62 g/mol |
| Exact Mass | 469.28 |
| IUPAC Name | (1S,3aS,3bS,5aR,9aR,9bS,11aS)-1-[2-[2-(1,1-difluoroethyl)phenyl]acetyl]-6,9a,11a-trimethyl-2,3,3a,3b,4,5,5a,9b,10,11-decahydro-1H-indeno[5,4-f]quinolin-7-one |
| SMILES | CN1C(=O)C=C[C@]2(C)[C@H]3CC[C@]4(C)[C@@H](C(=O)Cc5ccccc5C(C)(F)F)CC[C@H]4[C@@H]3CC[C@@H]12 |
| InChI | InChI=1S/C29H37F2NO2/c1-27-15-13-22-19(9-12-25-28(22,2)16-14-26(34)32(25)4)21(27)10-11-23(27)24(33)17-18-7-5-6-8-20(18)29(3,30)31/h5-8,14,16,19,21-23,25H,9-13,15,17H2,1-4H3/t19-,21-,22-,23+,25+,27-,28+/m0/s1 |
| InChIKey | WPHPHQZKFRTPCY-CGMRHEFZSA-N |
| XLogP | 6.17 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.62 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |