C25H26F2N6O3 — CID 167609697
1-[5-(1,1-difluoroethyl)-3-pyridinyl]-3-[4-[7-(methylamino)quinazolin-4-yl]oxycyclohexyl]imidazolidine-2,4-dione (PubChem CID 167609697) has the molecular formula C25H26F2N6O3 and a molecular weight of 496.52 g/mol. Its IUPAC name is 1-[5-(1,1-difluoroethyl)-3-pyridinyl]-3-[4-[7-(methylamino)quinazolin-4-yl]oxycyclohexyl]imidazolidine-2,4-dione.
| Compound Name | 1-[5-(1,1-difluoroethyl)-3-pyridinyl]-3-[4-[7-(methylamino)quinazolin-4-yl]oxycyclohexyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 167609697 |
| Molecular Formula | C25H26F2N6O3 |
| Molecular Weight | 496.52 g/mol |
| Exact Mass | 496.20 |
| IUPAC Name | 1-[5-(1,1-difluoroethyl)-3-pyridinyl]-3-[4-[7-(methylamino)quinazolin-4-yl]oxycyclohexyl]imidazolidine-2,4-dione |
| SMILES | CNc1ccc2c(OC3CCC(N4C(=O)CN(c5cncc(C(C)(F)F)c5)C4=O)CC3)ncnc2c1 |
| InChI | InChI=1S/C25H26F2N6O3/c1-25(26,27)15-9-18(12-29-11-15)32-13-22(34)33(24(32)35)17-4-6-19(7-5-17)36-23-20-8-3-16(28-2)10-21(20)30-14-31-23/h3,8-12,14,17,19,28H,4-7,13H2,1-2H3 |
| InChIKey | NWNJMQMBOMMYSA-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 100.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.52 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|