About 5-purin-7-ylpentan-2-one
5-purin-7-ylpentan-2-one (PubChem CID 167611303) has the molecular formula C10H12N4O
and a molecular weight of 204.23 g/mol. Its IUPAC name is 5-purin-7-ylpentan-2-one.
Molecular Properties
| Compound Name | 5-purin-7-ylpentan-2-one |
| PubChem CID | 167611303 |
| Molecular Formula | C10H12N4O |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.10 |
| IUPAC Name | 5-purin-7-ylpentan-2-one |
| SMILES | CC(=O)CCCn1cnc2ncncc21 |
| InChI | InChI=1S/C10H12N4O/c1-8(15)3-2-4-14-7-13-10-9(14)5-11-6-12-10/h5-7H,2-4H2,1H3 |
| InChIKey | MWLSIVSVQKJMPE-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-purin-7-ylpentan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-purin-7-ylpentan-2-one?
The IUPAC name of 5-purin-7-ylpentan-2-one (CID 167611303) is 5-purin-7-ylpentan-2-one.
What is the SMILES notation for 5-purin-7-ylpentan-2-one?
The canonical SMILES for 5-purin-7-ylpentan-2-one is CC(=O)CCCn1cnc2ncncc21.
What is the InChIKey of 5-purin-7-ylpentan-2-one?
The InChIKey is MWLSIVSVQKJMPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N4O/c1-8(15)3-2-4-14-7-13-10-9(14)5-11-6-12-10/h5-7H,2-4H2,1H3.
What are the key properties of 5-purin-7-ylpentan-2-one?
5-purin-7-ylpentan-2-one has a molecular weight of 204.23 g/mol, XLogP of 1.20, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-purin-7-ylpentan-2-one is sourced from PubChem (CID 167611303), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).