C25H33N5O5 — CID 167611884
N'-[(2R)-2-[2-(4-methoxy-1H-indol-2-yl)-2-oxoethyl]-4-methylpentanoyl]-N-[[(3S)-2-oxopyrrolidin-3-yl]methyl]aziridine-2-carbohydrazide (PubChem CID 167611884) has the molecular formula C25H33N5O5 and a molecular weight of 483.57 g/mol. Its IUPAC name is N'-[(2R)-2-[2-(4-methoxy-1H-indol-2-yl)-2-oxoethyl]-4-methylpentanoyl]-N-[[(3S)-2-oxopyrrolidin-3-yl]methyl]aziridine-2-carbohydrazide.
| Compound Name | N'-[(2R)-2-[2-(4-methoxy-1H-indol-2-yl)-2-oxoethyl]-4-methylpentanoyl]-N-[[(3S)-2-oxopyrrolidin-3-yl]methyl]aziridine-2-carbohydrazide |
|---|---|
| PubChem CID | 167611884 |
| Molecular Formula | C25H33N5O5 |
| Molecular Weight | 483.57 g/mol |
| Exact Mass | 483.25 |
| IUPAC Name | N'-[(2R)-2-[2-(4-methoxy-1H-indol-2-yl)-2-oxoethyl]-4-methylpentanoyl]-N-[[(3S)-2-oxopyrrolidin-3-yl]methyl]aziridine-2-carbohydrazide |
| SMILES | COc1cccc2[nH]c(C(=O)CC(CC(C)C)C(=O)NN(C[C@@H]3CCNC3=O)C(=O)C3CN3)cc12 |
| InChI | InChI=1S/C25H33N5O5/c1-14(2)9-16(10-21(31)19-11-17-18(28-19)5-4-6-22(17)35-3)24(33)29-30(25(34)20-12-27-20)13-15-7-8-26-23(15)32/h4-6,11,14-16,20,27-28H,7-10,12-13H2,1-3H3,(H,26,32)(H,29,33)/t15-,16?,20?/m0/s1 |
| InChIKey | LEAQTOMUPKTYFH-SHPPYHEDSA-N |
| XLogP | 1.38 |
| TPSA | 142.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.57 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|