C15H8ClF9N4O2 — CID 167612212
5-chloro-6-(2,2,3,3,4,4,5,5,5-nonafluoropentoxy)-N-pyridazin-1-ium-1-ylpyridine-3-carboximidate (PubChem CID 167612212) has the molecular formula C15H8ClF9N4O2 and a molecular weight of 482.69 g/mol. Its IUPAC name is 5-chloro-6-(2,2,3,3,4,4,5,5,5-nonafluoropentoxy)-N-pyridazin-1-ium-1-ylpyridine-3-carboximidate.
| Compound Name | 5-chloro-6-(2,2,3,3,4,4,5,5,5-nonafluoropentoxy)-N-pyridazin-1-ium-1-ylpyridine-3-carboximidate |
|---|---|
| PubChem CID | 167612212 |
| Molecular Formula | C15H8ClF9N4O2 |
| Molecular Weight | 482.69 g/mol |
| Exact Mass | 482.02 |
| IUPAC Name | 5-chloro-6-(2,2,3,3,4,4,5,5,5-nonafluoropentoxy)-N-pyridazin-1-ium-1-ylpyridine-3-carboximidate |
| SMILES | [O-]C(=N[n+]1ccccn1)c1cnc(OCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c(Cl)c1 |
| InChI | InChI=1S/C15H8ClF9N4O2/c16-9-5-8(10(30)28-29-4-2-1-3-27-29)6-26-11(9)31-7-12(17,18)13(19,20)14(21,22)15(23,24)25/h1-6H,7H2 |
| InChIKey | LFIHNRUUPCVEHB-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 74.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.69 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|