C25H25F2N5O4S — CID 167612477
6-[5-[[(2,4-difluorophenyl)-methylidene-oxo-λ6-sulfanyl]amino]-6-methoxy-3-pyridinyl]-8-(2-methoxyethoxy)-4-methylquinazolin-2-amine (PubChem CID 167612477) has the molecular formula C25H25F2N5O4S and a molecular weight of 529.57 g/mol. Its IUPAC name is 6-[5-[[(2,4-difluorophenyl)-methylidene-oxo-λ6-sulfanyl]amino]-6-methoxy-3-pyridinyl]-8-(2-methoxyethoxy)-4-methylquinazolin-2-amine.
| Compound Name | 6-[5-[[(2,4-difluorophenyl)-methylidene-oxo-λ6-sulfanyl]amino]-6-methoxy-3-pyridinyl]-8-(2-methoxyethoxy)-4-methylquinazolin-2-amine |
|---|---|
| PubChem CID | 167612477 |
| Molecular Formula | C25H25F2N5O4S |
| Molecular Weight | 529.57 g/mol |
| Exact Mass | 529.16 |
| IUPAC Name | 6-[5-[[(2,4-difluorophenyl)-methylidene-oxo-λ6-sulfanyl]amino]-6-methoxy-3-pyridinyl]-8-(2-methoxyethoxy)-4-methylquinazolin-2-amine |
| SMILES | C=S(=O)(Nc1cc(-c2cc(OCCOC)c3nc(N)nc(C)c3c2)cnc1OC)c1ccc(F)cc1F |
| InChI | InChI=1S/C25H25F2N5O4S/c1-14-18-9-15(11-21(36-8-7-34-2)23(18)31-25(28)30-14)16-10-20(24(35-3)29-13-16)32-37(4,33)22-6-5-17(26)12-19(22)27/h5-6,9-13H,4,7-8H2,1-3H3,(H,32,33)(H2,28,30,31) |
| InChIKey | KRIJIJJZJCPUNU-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 121.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.57 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|