C27H35ClN6O3 — CID 167613201
6-[[5-chloro-2-(4-methylpiperazin-1-yl)pyrimidin-4-yl]amino]-3-(2-oxobutoxy)-1-pentylquinolin-2-one (PubChem CID 167613201) has the molecular formula C27H35ClN6O3 and a molecular weight of 527.07 g/mol. Its IUPAC name is 6-[[5-chloro-2-(4-methylpiperazin-1-yl)pyrimidin-4-yl]amino]-3-(2-oxobutoxy)-1-pentylquinolin-2-one.
| Compound Name | 6-[[5-chloro-2-(4-methylpiperazin-1-yl)pyrimidin-4-yl]amino]-3-(2-oxobutoxy)-1-pentylquinolin-2-one |
|---|---|
| PubChem CID | 167613201 |
| Molecular Formula | C27H35ClN6O3 |
| Molecular Weight | 527.07 g/mol |
| Exact Mass | 526.25 |
| IUPAC Name | 6-[[5-chloro-2-(4-methylpiperazin-1-yl)pyrimidin-4-yl]amino]-3-(2-oxobutoxy)-1-pentylquinolin-2-one |
| SMILES | CCCCCn1c(=O)c(OCC(=O)CC)cc2cc(Nc3nc(N4CCN(C)CC4)ncc3Cl)ccc21 |
| InChI | InChI=1S/C27H35ClN6O3/c1-4-6-7-10-34-23-9-8-20(15-19(23)16-24(26(34)36)37-18-21(35)5-2)30-25-22(28)17-29-27(31-25)33-13-11-32(3)12-14-33/h8-9,15-17H,4-7,10-14,18H2,1-3H3,(H,29,30,31) |
| InChIKey | JENXPQWGVFIZMJ-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 92.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.07 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|