About (2,5-dioxopyrrolidin-1-yl) 4-[(2-chloroacetyl)amino]-3-(3-chloro-2-oxopropyl)benzoate
(2,5-dioxopyrrolidin-1-yl) 4-[(2-chloroacetyl)amino]-3-(3-chloro-2-oxopropyl)benzoate (PubChem CID 167613300) has the molecular formula C16H14Cl2N2O6
and a molecular weight of 401.20 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 4-[(2-chloroacetyl)amino]-3-(3-chloro-2-oxopropyl)benzoate.
Molecular Properties
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 4-[(2-chloroacetyl)amino]-3-(3-chloro-2-oxopropyl)benzoate |
| PubChem CID | 167613300 |
| Molecular Formula | C16H14Cl2N2O6 |
| Molecular Weight | 401.20 g/mol |
| Exact Mass | 400.02 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 4-[(2-chloroacetyl)amino]-3-(3-chloro-2-oxopropyl)benzoate |
| SMILES | O=C(CCl)Cc1cc(C(=O)ON2C(=O)CCC2=O)ccc1NC(=O)CCl |
| InChI | InChI=1S/C16H14Cl2N2O6/c17-7-11(21)6-10-5-9(1-2-12(10)19-13(22)8-18)16(25)26-20-14(23)3-4-15(20)24/h1-2,5H,3-4,6-8H2,(H,19,22) |
| InChIKey | LJFOJASMVUCNBR-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 401.20 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze (2,5-dioxopyrrolidin-1-yl) 4-[(2-chloroacetyl)amino]-3-(3-chloro-2-oxopropyl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,5-dioxopyrrolidin-1-yl) 4-[(2-chloroacetyl)amino]-3-(3-chloro-2-oxopropyl)benzoate?
The IUPAC name of (2,5-dioxopyrrolidin-1-yl) 4-[(2-chloroacetyl)amino]-3-(3-chloro-2-oxopropyl)benzoate (CID 167613300) is (2,5-dioxopyrrolidin-1-yl) 4-[(2-chloroacetyl)amino]-3-(3-chloro-2-oxopropyl)benzoate.
What is the SMILES notation for (2,5-dioxopyrrolidin-1-yl) 4-[(2-chloroacetyl)amino]-3-(3-chloro-2-oxopropyl)benzoate?
The canonical SMILES for (2,5-dioxopyrrolidin-1-yl) 4-[(2-chloroacetyl)amino]-3-(3-chloro-2-oxopropyl)benzoate is O=C(CCl)Cc1cc(C(=O)ON2C(=O)CCC2=O)ccc1NC(=O)CCl.
What is the InChIKey of (2,5-dioxopyrrolidin-1-yl) 4-[(2-chloroacetyl)amino]-3-(3-chloro-2-oxopropyl)benzoate?
The InChIKey is LJFOJASMVUCNBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14Cl2N2O6/c17-7-11(21)6-10-5-9(1-2-12(10)19-13(22)8-18)16(25)26-20-14(23)3-4-15(20)24/h1-2,5H,3-4,6-8H2,(H,19,22).
What are the key properties of (2,5-dioxopyrrolidin-1-yl) 4-[(2-chloroacetyl)amino]-3-(3-chloro-2-oxopropyl)benzoate?
(2,5-dioxopyrrolidin-1-yl) 4-[(2-chloroacetyl)amino]-3-(3-chloro-2-oxopropyl)benzoate has a molecular weight of 401.20 g/mol, XLogP of 1.44, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2,5-dioxopyrrolidin-1-yl) 4-[(2-chloroacetyl)amino]-3-(3-chloro-2-oxopropyl)benzoate is sourced from PubChem (CID 167613300), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).