C20H25F2N3O3 — CID 167614275
5-[(E)-2-[4-(1,1-difluoroethyl)cyclohexyl]ethenyl]-6-methoxy-3-(prop-2-enoylamino)pyridine-2-carboxamide (PubChem CID 167614275) has the molecular formula C20H25F2N3O3 and a molecular weight of 393.43 g/mol. Its IUPAC name is 5-[(E)-2-[4-(1,1-difluoroethyl)cyclohexyl]ethenyl]-6-methoxy-3-(prop-2-enoylamino)pyridine-2-carboxamide.
| Compound Name | 5-[(E)-2-[4-(1,1-difluoroethyl)cyclohexyl]ethenyl]-6-methoxy-3-(prop-2-enoylamino)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 167614275 |
| Molecular Formula | C20H25F2N3O3 |
| Molecular Weight | 393.43 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | 5-[(E)-2-[4-(1,1-difluoroethyl)cyclohexyl]ethenyl]-6-methoxy-3-(prop-2-enoylamino)pyridine-2-carboxamide |
| SMILES | C=CC(=O)Nc1cc(/C=C/C2CCC(C(C)(F)F)CC2)c(OC)nc1C(N)=O |
| InChI | InChI=1S/C20H25F2N3O3/c1-4-16(26)24-15-11-13(19(28-3)25-17(15)18(23)27)8-5-12-6-9-14(10-7-12)20(2,21)22/h4-5,8,11-12,14H,1,6-7,9-10H2,2-3H3,(H2,23,27)(H,24,26)/b8-5+ |
| InChIKey | ZZMRKVKGYLKPHP-VMPITWQZSA-N |
| XLogP | 3.79 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.43 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|