C15H17N7O2S — CID 16761501
[(E)-[(1R,2R,5S)-2-[5-(4-methylphenyl)tetrazol-1-yl]-6,8-dioxabicyclo[3.2.1]octan-4-ylidene]amino]thiourea (PubChem CID 16761501) has the molecular formula C15H17N7O2S and a molecular weight of 359.42 g/mol. Its IUPAC name is [(E)-[(1R,2R,5S)-2-[5-(4-methylphenyl)tetrazol-1-yl]-6,8-dioxabicyclo[3.2.1]octan-4-ylidene]amino]thiourea.
| Compound Name | [(E)-[(1R,2R,5S)-2-[5-(4-methylphenyl)tetrazol-1-yl]-6,8-dioxabicyclo[3.2.1]octan-4-ylidene]amino]thiourea |
|---|---|
| PubChem CID | 16761501 |
| Molecular Formula | C15H17N7O2S |
| Molecular Weight | 359.42 g/mol |
| Exact Mass | 359.12 |
| IUPAC Name | [(E)-[(1R,2R,5S)-2-[5-(4-methylphenyl)tetrazol-1-yl]-6,8-dioxabicyclo[3.2.1]octan-4-ylidene]amino]thiourea |
| SMILES | Cc1ccc(-c2nnnn2[C@@H]2C/C(=N\NC(N)=S)[C@H]3OC[C@@H]2O3)cc1 |
| InChI | InChI=1S/C15H17N7O2S/c1-8-2-4-9(5-3-8)13-18-20-21-22(13)11-6-10(17-19-15(16)25)14-23-7-12(11)24-14/h2-5,11-12,14H,6-7H2,1H3,(H3,16,19,25)/b17-10+/t11-,12+,14+/m1/s1 |
| InChIKey | YYSSBGGIXORYLW-CINXWKKMSA-N |
| XLogP | 0.52 |
| TPSA | 112.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.42 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|