C31H36N2O6 — CID 167615277
1-[1-(2,4-dimethylphenyl)-6-methoxy-7-[2-(4-methoxy-3-nitrophenyl)ethoxy]-3,4-dihydro-1H-isoquinolin-2-yl]butan-1-one (PubChem CID 167615277) has the molecular formula C31H36N2O6 and a molecular weight of 532.64 g/mol. Its IUPAC name is 1-[1-(2,4-dimethylphenyl)-6-methoxy-7-[2-(4-methoxy-3-nitrophenyl)ethoxy]-3,4-dihydro-1H-isoquinolin-2-yl]butan-1-one.
| Compound Name | 1-[1-(2,4-dimethylphenyl)-6-methoxy-7-[2-(4-methoxy-3-nitrophenyl)ethoxy]-3,4-dihydro-1H-isoquinolin-2-yl]butan-1-one |
|---|---|
| PubChem CID | 167615277 |
| Molecular Formula | C31H36N2O6 |
| Molecular Weight | 532.64 g/mol |
| Exact Mass | 532.26 |
| IUPAC Name | 1-[1-(2,4-dimethylphenyl)-6-methoxy-7-[2-(4-methoxy-3-nitrophenyl)ethoxy]-3,4-dihydro-1H-isoquinolin-2-yl]butan-1-one |
| SMILES | CCCC(=O)N1CCc2cc(OC)c(OCCc3ccc(OC)c([N+](=O)[O-])c3)cc2C1c1ccc(C)cc1C |
| InChI | InChI=1S/C31H36N2O6/c1-6-7-30(34)32-14-12-23-18-28(38-5)29(19-25(23)31(32)24-10-8-20(2)16-21(24)3)39-15-13-22-9-11-27(37-4)26(17-22)33(35)36/h8-11,16-19,31H,6-7,12-15H2,1-5H3 |
| InChIKey | XPSFNYMUBFJOTM-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 91.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.64 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|