C26H19Cl2NO2 — CID 16761571
2,4-dichloro-6-(4,4-diphenyl-1,2-dihydro-3,1-benzoxazin-2-yl)phenol (PubChem CID 16761571) has the molecular formula C26H19Cl2NO2 and a molecular weight of 448.35 g/mol. Its IUPAC name is 2,4-dichloro-6-(4,4-diphenyl-1,2-dihydro-3,1-benzoxazin-2-yl)phenol.
| Compound Name | 2,4-dichloro-6-(4,4-diphenyl-1,2-dihydro-3,1-benzoxazin-2-yl)phenol |
|---|---|
| PubChem CID | 16761571 |
| Molecular Formula | C26H19Cl2NO2 |
| Molecular Weight | 448.35 g/mol |
| Exact Mass | 447.08 |
| IUPAC Name | 2,4-dichloro-6-(4,4-diphenyl-1,2-dihydro-3,1-benzoxazin-2-yl)phenol |
| SMILES | Oc1c(Cl)cc(Cl)cc1C1Nc2ccccc2C(c2ccccc2)(c2ccccc2)O1 |
| InChI | InChI=1S/C26H19Cl2NO2/c27-19-15-20(24(30)22(28)16-19)25-29-23-14-8-7-13-21(23)26(31-25,17-9-3-1-4-10-17)18-11-5-2-6-12-18/h1-16,25,29-30H |
| InChIKey | QORKFCUJENAXDK-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.35 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|