About 4-benzylsulfanyl-1-ethyl-3-methylpyrazole;1-ethyl-3-methylpyrazole-4-sulfonyl chloride
4-benzylsulfanyl-1-ethyl-3-methylpyrazole;1-ethyl-3-methylpyrazole-4-sulfonyl chloride (PubChem CID 167616288) has the molecular formula C19H25ClN4O2S2
and a molecular weight of 441.02 g/mol. Its IUPAC name is 4-benzylsulfanyl-1-ethyl-3-methylpyrazole;1-ethyl-3-methylpyrazole-4-sulfonyl chloride.
Molecular Properties
| Compound Name | 4-benzylsulfanyl-1-ethyl-3-methylpyrazole;1-ethyl-3-methylpyrazole-4-sulfonyl chloride |
| PubChem CID | 167616288 |
| Molecular Formula | C19H25ClN4O2S2 |
| Molecular Weight | 441.02 g/mol |
| Exact Mass | 440.11 |
| IUPAC Name | 4-benzylsulfanyl-1-ethyl-3-methylpyrazole;1-ethyl-3-methylpyrazole-4-sulfonyl chloride |
| SMILES | CCn1cc(S(=O)(=O)Cl)c(C)n1.CCn1cc(SCc2ccccc2)c(C)n1 |
| InChI | InChI=1S/C13H16N2S.C6H9ClN2O2S/c1-3-15-9-13(11(2)14-15)16-10-12-7-5-4-6-8-12;1-3-9-4-6(5(2)8-9)12(7,10)11/h4-9H,3,10H2,1-2H3;4H,3H2,1-2H3 |
| InChIKey | LUCHODIRCIPTSX-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 69.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 441.02 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4-benzylsulfanyl-1-ethyl-3-methylpyrazole;1-ethyl-3-methylpyrazole-4-sulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-benzylsulfanyl-1-ethyl-3-methylpyrazole;1-ethyl-3-methylpyrazole-4-sulfonyl chloride?
The IUPAC name of 4-benzylsulfanyl-1-ethyl-3-methylpyrazole;1-ethyl-3-methylpyrazole-4-sulfonyl chloride (CID 167616288) is 4-benzylsulfanyl-1-ethyl-3-methylpyrazole;1-ethyl-3-methylpyrazole-4-sulfonyl chloride.
What is the SMILES notation for 4-benzylsulfanyl-1-ethyl-3-methylpyrazole;1-ethyl-3-methylpyrazole-4-sulfonyl chloride?
The canonical SMILES for 4-benzylsulfanyl-1-ethyl-3-methylpyrazole;1-ethyl-3-methylpyrazole-4-sulfonyl chloride is CCn1cc(S(=O)(=O)Cl)c(C)n1.CCn1cc(SCc2ccccc2)c(C)n1.
What is the InChIKey of 4-benzylsulfanyl-1-ethyl-3-methylpyrazole;1-ethyl-3-methylpyrazole-4-sulfonyl chloride?
The InChIKey is LUCHODIRCIPTSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N2S.C6H9ClN2O2S/c1-3-15-9-13(11(2)14-15)16-10-12-7-5-4-6-8-12;1-3-9-4-6(5(2)8-9)12(7,10)11/h4-9H,3,10H2,1-2H3;4H,3H2,1-2H3.
What are the key properties of 4-benzylsulfanyl-1-ethyl-3-methylpyrazole;1-ethyl-3-methylpyrazole-4-sulfonyl chloride?
4-benzylsulfanyl-1-ethyl-3-methylpyrazole;1-ethyl-3-methylpyrazole-4-sulfonyl chloride has a molecular weight of 441.02 g/mol, XLogP of 4.64, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-benzylsulfanyl-1-ethyl-3-methylpyrazole;1-ethyl-3-methylpyrazole-4-sulfonyl chloride is sourced from PubChem (CID 167616288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).