C17H18F3N3O3S — CID 167617967
1-methyl-6-methylsulfinyl-1,2-dihydrobenzo[e]indole-3-carboximidamide;2,2,2-trifluoroacetic acid (PubChem CID 167617967) has the molecular formula C17H18F3N3O3S and a molecular weight of 401.41 g/mol. Its IUPAC name is 1-methyl-6-methylsulfinyl-1,2-dihydrobenzo[e]indole-3-carboximidamide;2,2,2-trifluoroacetic acid.
| Compound Name | 1-methyl-6-methylsulfinyl-1,2-dihydrobenzo[e]indole-3-carboximidamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 167617967 |
| Molecular Formula | C17H18F3N3O3S |
| Molecular Weight | 401.41 g/mol |
| Exact Mass | 401.10 |
| IUPAC Name | 1-methyl-6-methylsulfinyl-1,2-dihydrobenzo[e]indole-3-carboximidamide;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.[H]/N=C(\N)N1CC(C)c2c1ccc1c(S(C)=O)cccc21 |
| InChI | InChI=1S/C15H17N3OS.C2HF3O2/c1-9-8-18(15(16)17)12-7-6-10-11(14(9)12)4-3-5-13(10)20(2)19;3-2(4,5)1(6)7/h3-7,9H,8H2,1-2H3,(H3,16,17);(H,6,7) |
| InChIKey | OCCARNZUVGQRFH-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 107.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.41 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|