C6H8F4N2O2 — CID 167618234
2,2,4,4-tetrafluorohexanediamide (PubChem CID 167618234) has the molecular formula C6H8F4N2O2 and a molecular weight of 216.13 g/mol. Its IUPAC name is 2,2,4,4-tetrafluorohexanediamide.
| Compound Name | 2,2,4,4-tetrafluorohexanediamide |
|---|---|
| PubChem CID | 167618234 |
| Molecular Formula | C6H8F4N2O2 |
| Molecular Weight | 216.13 g/mol |
| Exact Mass | 216.05 |
| IUPAC Name | 2,2,4,4-tetrafluorohexanediamide |
| SMILES | NC(=O)CC(F)(F)CC(F)(F)C(N)=O |
| InChI | InChI=1S/C6H8F4N2O2/c7-5(8,1-3(11)13)2-6(9,10)4(12)14/h1-2H2,(H2,11,13)(H2,12,14) |
| InChIKey | ZTPUEVQZYOMUDX-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.13 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |