C27H27FN4O4 — CID 167618716
(2S)-4-fluoro-1-[4-[6-[6-(2-methoxyethoxy)-3-pyridinyl]quinolin-4-yl]-4-oxobutanoyl]-4-methylpyrrolidine-2-carbonitrile (PubChem CID 167618716) has the molecular formula C27H27FN4O4 and a molecular weight of 490.54 g/mol. Its IUPAC name is (2S)-4-fluoro-1-[4-[6-[6-(2-methoxyethoxy)-3-pyridinyl]quinolin-4-yl]-4-oxobutanoyl]-4-methylpyrrolidine-2-carbonitrile.
| Compound Name | (2S)-4-fluoro-1-[4-[6-[6-(2-methoxyethoxy)-3-pyridinyl]quinolin-4-yl]-4-oxobutanoyl]-4-methylpyrrolidine-2-carbonitrile |
|---|---|
| PubChem CID | 167618716 |
| Molecular Formula | C27H27FN4O4 |
| Molecular Weight | 490.54 g/mol |
| Exact Mass | 490.20 |
| IUPAC Name | (2S)-4-fluoro-1-[4-[6-[6-(2-methoxyethoxy)-3-pyridinyl]quinolin-4-yl]-4-oxobutanoyl]-4-methylpyrrolidine-2-carbonitrile |
| SMILES | COCCOc1ccc(-c2ccc3nccc(C(=O)CCC(=O)N4CC(C)(F)C[C@H]4C#N)c3c2)cn1 |
| InChI | InChI=1S/C27H27FN4O4/c1-27(28)14-20(15-29)32(17-27)26(34)8-6-24(33)21-9-10-30-23-5-3-18(13-22(21)23)19-4-7-25(31-16-19)36-12-11-35-2/h3-5,7,9-10,13,16,20H,6,8,11-12,14,17H2,1-2H3/t20-,27?/m0/s1 |
| InChIKey | BFPYUFWRYDXMBU-SVQMELKDSA-N |
| XLogP | 4.14 |
| TPSA | 105.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.54 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|