C23H14F6N4O8 — CID 167618927
(4R,5S)-9-methyl-7-(2-methyl-4-nitrophenyl)-2-[4-nitro-2-(trifluoromethyl)phenyl]-4-(trifluoromethyl)-2,7-diazaspiro[4.4]nonane-1,3,6,8-tetrone (PubChem CID 167618927) has the molecular formula C23H14F6N4O8 and a molecular weight of 588.37 g/mol. Its IUPAC name is (4R,5S)-9-methyl-7-(2-methyl-4-nitrophenyl)-2-[4-nitro-2-(trifluoromethyl)phenyl]-4-(trifluoromethyl)-2,7-diazaspiro[4.4]nonane-1,3,6,8-tetrone.
| Compound Name | (4R,5S)-9-methyl-7-(2-methyl-4-nitrophenyl)-2-[4-nitro-2-(trifluoromethyl)phenyl]-4-(trifluoromethyl)-2,7-diazaspiro[4.4]nonane-1,3,6,8-tetrone |
|---|---|
| PubChem CID | 167618927 |
| Molecular Formula | C23H14F6N4O8 |
| Molecular Weight | 588.37 g/mol |
| Exact Mass | 588.07 |
| IUPAC Name | (4R,5S)-9-methyl-7-(2-methyl-4-nitrophenyl)-2-[4-nitro-2-(trifluoromethyl)phenyl]-4-(trifluoromethyl)-2,7-diazaspiro[4.4]nonane-1,3,6,8-tetrone |
| SMILES | Cc1cc([N+](=O)[O-])ccc1N1C(=O)C(C)[C@]2(C1=O)C(=O)N(c1ccc([N+](=O)[O-])cc1C(F)(F)F)C(=O)[C@@H]2C(F)(F)F |
| InChI | InChI=1S/C23H14F6N4O8/c1-9-7-11(32(38)39)3-5-14(9)30-17(34)10(2)21(19(30)36)16(23(27,28)29)18(35)31(20(21)37)15-6-4-12(33(40)41)8-13(15)22(24,25)26/h3-8,10,16H,1-2H3/t10?,16-,21-/m0/s1 |
| InChIKey | KMGCBZBQVIWYEF-ZQQGWFCYSA-N |
| XLogP | 4.08 |
| TPSA | 161.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.37 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|