C10H6F9N — CID 167619078
2,6-dimethyl-3,4,5-tris(trifluoromethyl)pyridine (PubChem CID 167619078) has the molecular formula C10H6F9N and a molecular weight of 311.15 g/mol. Its IUPAC name is 2,6-dimethyl-3,4,5-tris(trifluoromethyl)pyridine.
| Compound Name | 2,6-dimethyl-3,4,5-tris(trifluoromethyl)pyridine |
|---|---|
| PubChem CID | 167619078 |
| Molecular Formula | C10H6F9N |
| Molecular Weight | 311.15 g/mol |
| Exact Mass | 311.04 |
| IUPAC Name | 2,6-dimethyl-3,4,5-tris(trifluoromethyl)pyridine |
| SMILES | Cc1nc(C)c(C(F)(F)F)c(C(F)(F)F)c1C(F)(F)F |
| InChI | InChI=1S/C10H6F9N/c1-3-5(8(11,12)13)7(10(17,18)19)6(4(2)20-3)9(14,15)16/h1-2H3 |
| InChIKey | LDGFQLTZUGJRPS-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.15 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |