C36H66O4 — CID 167619322
(2R,3S,5R)-2,3,4-tris(dec-9-enoxy)-5-ethyloxolane (PubChem CID 167619322) has the molecular formula C36H66O4 and a molecular weight of 562.92 g/mol. Its IUPAC name is (2R,3S,5R)-2,3,4-tris(dec-9-enoxy)-5-ethyloxolane.
| Compound Name | (2R,3S,5R)-2,3,4-tris(dec-9-enoxy)-5-ethyloxolane |
|---|---|
| PubChem CID | 167619322 |
| Molecular Formula | C36H66O4 |
| Molecular Weight | 562.92 g/mol |
| Exact Mass | 562.50 |
| IUPAC Name | (2R,3S,5R)-2,3,4-tris(dec-9-enoxy)-5-ethyloxolane |
| SMILES | C=CCCCCCCCCOC1[C@@H](CC)O[C@@H](OCCCCCCCCC=C)[C@H]1OCCCCCCCCC=C |
| InChI | InChI=1S/C36H66O4/c1-5-9-12-15-18-21-24-27-30-37-34-33(8-4)40-36(39-32-29-26-23-20-17-14-11-7-3)35(34)38-31-28-25-22-19-16-13-10-6-2/h5-7,33-36H,1-3,8-32H2,4H3/t33-,34?,35+,36-/m1/s1 |
| InChIKey | MFAQDZQDLJPHEV-ABUCHCICSA-N |
| XLogP | 10.66 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.92 |
| LogP ≤ 5 | 10.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|