C27H32N6O5 — CID 167619700
2-[6-[(2R,4S,5R)-5-ethyl-4-methyl-2-[2-oxo-4-(1,2,4-triazol-1-yl)pyrimidin-1-yl]oxolan-3-yl]oxyhexyl]isoindole-1,3-dione (PubChem CID 167619700) has the molecular formula C27H32N6O5 and a molecular weight of 520.59 g/mol. Its IUPAC name is 2-[6-[(2R,4S,5R)-5-ethyl-4-methyl-2-[2-oxo-4-(1,2,4-triazol-1-yl)pyrimidin-1-yl]oxolan-3-yl]oxyhexyl]isoindole-1,3-dione.
| Compound Name | 2-[6-[(2R,4S,5R)-5-ethyl-4-methyl-2-[2-oxo-4-(1,2,4-triazol-1-yl)pyrimidin-1-yl]oxolan-3-yl]oxyhexyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 167619700 |
| Molecular Formula | C27H32N6O5 |
| Molecular Weight | 520.59 g/mol |
| Exact Mass | 520.24 |
| IUPAC Name | 2-[6-[(2R,4S,5R)-5-ethyl-4-methyl-2-[2-oxo-4-(1,2,4-triazol-1-yl)pyrimidin-1-yl]oxolan-3-yl]oxyhexyl]isoindole-1,3-dione |
| SMILES | CC[C@H]1O[C@@H](n2ccc(-n3cncn3)nc2=O)C(OCCCCCCN2C(=O)c3ccccc3C2=O)[C@H]1C |
| InChI | InChI=1S/C27H32N6O5/c1-3-21-18(2)23(26(38-21)32-14-12-22(30-27(32)36)33-17-28-16-29-33)37-15-9-5-4-8-13-31-24(34)19-10-6-7-11-20(19)25(31)35/h6-7,10-12,14,16-18,21,23,26H,3-5,8-9,13,15H2,1-2H3/t18-,21+,23?,26+/m0/s1 |
| InChIKey | AWUXBTXBTKKPDI-PVRMSARCSA-N |
| XLogP | 3.01 |
| TPSA | 121.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.59 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|