C16H23F3O6 — CID 167620947
(2-oxo-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxol-5-yl)methyl 2-methyl-2-(2,2,2-trifluoroethoxymethyl)butanoate (PubChem CID 167620947) has the molecular formula C16H23F3O6 and a molecular weight of 368.35 g/mol. Its IUPAC name is (2-oxo-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxol-5-yl)methyl 2-methyl-2-(2,2,2-trifluoroethoxymethyl)butanoate.
| Compound Name | (2-oxo-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxol-5-yl)methyl 2-methyl-2-(2,2,2-trifluoroethoxymethyl)butanoate |
|---|---|
| PubChem CID | 167620947 |
| Molecular Formula | C16H23F3O6 |
| Molecular Weight | 368.35 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | (2-oxo-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxol-5-yl)methyl 2-methyl-2-(2,2,2-trifluoroethoxymethyl)butanoate |
| SMILES | CCC(C)(COCC(F)(F)F)C(=O)OCC1CCC2OC(=O)OC2C1 |
| InChI | InChI=1S/C16H23F3O6/c1-3-15(2,8-22-9-16(17,18)19)13(20)23-7-10-4-5-11-12(6-10)25-14(21)24-11/h10-12H,3-9H2,1-2H3 |
| InChIKey | VRQJNARCRRJYHB-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.35 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |