About CID 167621037
CID 167621037 (PubChem CID 167621037) has the molecular formula C9H17B10N3
and a molecular weight of 275.38 g/mol.
Molecular Properties
| Compound Name | CID 167621037 |
| PubChem CID | 167621037 |
| Molecular Formula | C9H17B10N3 |
| Molecular Weight | 275.38 g/mol |
| Exact Mass | 277.24 |
| IUPAC Name | — |
| SMILES | CC1CCC(CCN=[N+]=[N-])CC1.[B]B([B])B(B([B])[B])B([B])[B] |
| InChI | InChI=1S/C9H17N3.B10/c1-8-2-4-9(5-3-8)6-7-11-12-10;1-7(2)10(8(3)4)9(5)6/h8-9H,2-7H2,1H3; |
| InChIKey | HMZRTRPGQFIXQW-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.38 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze CID 167621037 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 167621037?
The IUPAC name of CID 167621037 (CID 167621037) is not available.
What is the SMILES notation for CID 167621037?
The canonical SMILES for CID 167621037 is CC1CCC(CCN=[N+]=[N-])CC1.[B]B([B])B(B([B])[B])B([B])[B].
What is the InChIKey of CID 167621037?
The InChIKey is HMZRTRPGQFIXQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17N3.B10/c1-8-2-4-9(5-3-8)6-7-11-12-10;1-7(2)10(8(3)4)9(5)6/h8-9H,2-7H2,1H3;.
What are the key properties of CID 167621037?
CID 167621037 has a molecular weight of 275.38 g/mol, XLogP of -0.29, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 167621037 is sourced from PubChem (CID 167621037), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).