About methane;1-(7-methyl-6-oxooctyl)-3-propan-2-ylsulfanylpyrrolidine-2,5-dione
methane;1-(7-methyl-6-oxooctyl)-3-propan-2-ylsulfanylpyrrolidine-2,5-dione (PubChem CID 167621427) has the molecular formula C17H31NO3S
and a molecular weight of 329.51 g/mol. Its IUPAC name is methane;1-(7-methyl-6-oxooctyl)-3-propan-2-ylsulfanylpyrrolidine-2,5-dione.
Molecular Properties
| Compound Name | methane;1-(7-methyl-6-oxooctyl)-3-propan-2-ylsulfanylpyrrolidine-2,5-dione |
| PubChem CID | 167621427 |
| Molecular Formula | C17H31NO3S |
| Molecular Weight | 329.51 g/mol |
| Exact Mass | 329.20 |
| IUPAC Name | methane;1-(7-methyl-6-oxooctyl)-3-propan-2-ylsulfanylpyrrolidine-2,5-dione |
| SMILES | C.CC(C)SC1CC(=O)N(CCCCCC(=O)C(C)C)C1=O |
| InChI | InChI=1S/C16H27NO3S.CH4/c1-11(2)13(18)8-6-5-7-9-17-15(19)10-14(16(17)20)21-12(3)4;/h11-12,14H,5-10H2,1-4H3;1H4 |
| InChIKey | MMLZSFLUFWYSJO-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.51 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze methane;1-(7-methyl-6-oxooctyl)-3-propan-2-ylsulfanylpyrrolidine-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;1-(7-methyl-6-oxooctyl)-3-propan-2-ylsulfanylpyrrolidine-2,5-dione?
The IUPAC name of methane;1-(7-methyl-6-oxooctyl)-3-propan-2-ylsulfanylpyrrolidine-2,5-dione (CID 167621427) is methane;1-(7-methyl-6-oxooctyl)-3-propan-2-ylsulfanylpyrrolidine-2,5-dione.
What is the SMILES notation for methane;1-(7-methyl-6-oxooctyl)-3-propan-2-ylsulfanylpyrrolidine-2,5-dione?
The canonical SMILES for methane;1-(7-methyl-6-oxooctyl)-3-propan-2-ylsulfanylpyrrolidine-2,5-dione is C.CC(C)SC1CC(=O)N(CCCCCC(=O)C(C)C)C1=O.
What is the InChIKey of methane;1-(7-methyl-6-oxooctyl)-3-propan-2-ylsulfanylpyrrolidine-2,5-dione?
The InChIKey is MMLZSFLUFWYSJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H27NO3S.CH4/c1-11(2)13(18)8-6-5-7-9-17-15(19)10-14(16(17)20)21-12(3)4;/h11-12,14H,5-10H2,1-4H3;1H4.
What are the key properties of methane;1-(7-methyl-6-oxooctyl)-3-propan-2-ylsulfanylpyrrolidine-2,5-dione?
methane;1-(7-methyl-6-oxooctyl)-3-propan-2-ylsulfanylpyrrolidine-2,5-dione has a molecular weight of 329.51 g/mol, XLogP of 3.68, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methane;1-(7-methyl-6-oxooctyl)-3-propan-2-ylsulfanylpyrrolidine-2,5-dione is sourced from PubChem (CID 167621427), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).