C26H32N4O5 — CID 167621944
6-[4-(1,4-dioxaspiro[4.5]decan-8-ylmethyl)-5-nitro-2-propan-2-ylphenyl]-8-methoxy-7-methyl-[1,2,4]triazolo[1,5-a]pyridine (PubChem CID 167621944) has the molecular formula C26H32N4O5 and a molecular weight of 480.57 g/mol. Its IUPAC name is 6-[4-(1,4-dioxaspiro[4.5]decan-8-ylmethyl)-5-nitro-2-propan-2-ylphenyl]-8-methoxy-7-methyl-[1,2,4]triazolo[1,5-a]pyridine.
| Compound Name | 6-[4-(1,4-dioxaspiro[4.5]decan-8-ylmethyl)-5-nitro-2-propan-2-ylphenyl]-8-methoxy-7-methyl-[1,2,4]triazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 167621944 |
| Molecular Formula | C26H32N4O5 |
| Molecular Weight | 480.57 g/mol |
| Exact Mass | 480.24 |
| IUPAC Name | 6-[4-(1,4-dioxaspiro[4.5]decan-8-ylmethyl)-5-nitro-2-propan-2-ylphenyl]-8-methoxy-7-methyl-[1,2,4]triazolo[1,5-a]pyridine |
| SMILES | COc1c(C)c(-c2cc([N+](=O)[O-])c(CC3CCC4(CC3)OCCO4)cc2C(C)C)cn2ncnc12 |
| InChI | InChI=1S/C26H32N4O5/c1-16(2)20-12-19(11-18-5-7-26(8-6-18)34-9-10-35-26)23(30(31)32)13-21(20)22-14-29-25(27-15-28-29)24(33-4)17(22)3/h12-16,18H,5-11H2,1-4H3 |
| InChIKey | MOHWJNMCDDDHBV-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 101.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.57 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|