C22H27Br2ClN4O10 — CID 167621966
5-bromo-2-chloro-3-nitropyridine;5-bromo-2-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]-3-nitropyridine;(2,2-dimethyl-1,3-dioxolan-4-yl)methanol (PubChem CID 167621966) has the molecular formula C22H27Br2ClN4O10 and a molecular weight of 702.74 g/mol. Its IUPAC name is 5-bromo-2-chloro-3-nitropyridine;5-bromo-2-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]-3-nitropyridine;(2,2-dimethyl-1,3-dioxolan-4-yl)methanol.
| Compound Name | 5-bromo-2-chloro-3-nitropyridine;5-bromo-2-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]-3-nitropyridine;(2,2-dimethyl-1,3-dioxolan-4-yl)methanol |
|---|---|
| PubChem CID | 167621966 |
| Molecular Formula | C22H27Br2ClN4O10 |
| Molecular Weight | 702.74 g/mol |
| Exact Mass | 699.98 |
| IUPAC Name | 5-bromo-2-chloro-3-nitropyridine;5-bromo-2-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]-3-nitropyridine;(2,2-dimethyl-1,3-dioxolan-4-yl)methanol |
| SMILES | CC1(C)OCC(CO)O1.CC1(C)OCC(COc2ncc(Br)cc2[N+](=O)[O-])O1.O=[N+]([O-])c1cc(Br)cnc1Cl |
| InChI | InChI=1S/C11H13BrN2O5.C6H12O3.C5H2BrClN2O2/c1-11(2)18-6-8(19-11)5-17-10-9(14(15)16)3-7(12)4-13-10;1-6(2)8-4-5(3-7)9-6;6-3-1-4(9(10)11)5(7)8-2-3/h3-4,8H,5-6H2,1-2H3;5,7H,3-4H2,1-2H3;1-2H |
| InChIKey | MOKSWTUXBKIHMA-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 178.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.74 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|