C18H36O4Si — CID 167622270
(4R)-4-[(2R,3R,5R,6S)-3-[tert-butyl(dimethyl)silyl]oxy-5,6-dimethyloxan-2-yl]oxypentanal (PubChem CID 167622270) has the molecular formula C18H36O4Si and a molecular weight of 344.57 g/mol. Its IUPAC name is (4R)-4-[(2R,3R,5R,6S)-3-[tert-butyl(dimethyl)silyl]oxy-5,6-dimethyloxan-2-yl]oxypentanal.
| Compound Name | (4R)-4-[(2R,3R,5R,6S)-3-[tert-butyl(dimethyl)silyl]oxy-5,6-dimethyloxan-2-yl]oxypentanal |
|---|---|
| PubChem CID | 167622270 |
| Molecular Formula | C18H36O4Si |
| Molecular Weight | 344.57 g/mol |
| Exact Mass | 344.24 |
| IUPAC Name | (4R)-4-[(2R,3R,5R,6S)-3-[tert-butyl(dimethyl)silyl]oxy-5,6-dimethyloxan-2-yl]oxypentanal |
| SMILES | C[C@H](CCC=O)O[C@@H]1O[C@@H](C)[C@H](C)C[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H36O4Si/c1-13-12-16(22-23(7,8)18(4,5)6)17(21-15(13)3)20-14(2)10-9-11-19/h11,13-17H,9-10,12H2,1-8H3/t13-,14-,15+,16-,17-/m1/s1 |
| InChIKey | MPMNQJQGGJALBE-NQNKBUKLSA-N |
| XLogP | 4.53 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.57 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|